C23H37N5O5 — CID 18305342
2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid (PubChem CID 18305342) has the molecular formula C23H37N5O5 and a molecular weight of 463.58 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18305342 |
| Molecular Formula | C23H37N5O5 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)acetyl]amino]-3-phenylpropanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C23H37N5O5/c1-3-15(2)20(23(32)33)28-22(31)18(13-16-9-5-4-6-10-16)27-19(29)14-26-21(30)17(25)11-7-8-12-24/h4-6,9-10,15,17-18,20H,3,7-8,11-14,24-25H2,1-2H3,(H,26,30)(H,27,29)(H,28,31)(H,32,33) |
| InChIKey | ZKZWKVVOGNKHSG-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|