C18H33N5O7S — CID 18309925
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid (PubChem CID 18309925) has the molecular formula C18H33N5O7S and a molecular weight of 463.56 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18309925 |
| Molecular Formula | C18H33N5O7S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylbutanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
| SMILES | CC(C)C(NC(=O)C(N)CCCCN)C(=O)NC(CS)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H33N5O7S/c1-9(2)14(23-15(26)10(20)5-3-4-6-19)17(28)22-12(8-31)16(27)21-11(18(29)30)7-13(24)25/h9-12,14,31H,3-8,19-20H2,1-2H3,(H,21,27)(H,22,28)(H,23,26)(H,24,25)(H,29,30) |
| InChIKey | RPOPTTGFSWMEAY-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|