C28H42BrN5O — CID 18315306
4-bromo-N-[4-[4-(2,6-ditert-butylpyrimidin-4-yl)-1,4-diazepan-1-yl]butyl]benzamide (PubChem CID 18315306) has the molecular formula C28H42BrN5O and a molecular weight of 544.58 g/mol. Its IUPAC name is 4-bromo-N-[4-[4-(2,6-ditert-butylpyrimidin-4-yl)-1,4-diazepan-1-yl]butyl]benzamide.
| Compound Name | 4-bromo-N-[4-[4-(2,6-ditert-butylpyrimidin-4-yl)-1,4-diazepan-1-yl]butyl]benzamide |
|---|---|
| PubChem CID | 18315306 |
| Molecular Formula | C28H42BrN5O |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | 4-bromo-N-[4-[4-(2,6-ditert-butylpyrimidin-4-yl)-1,4-diazepan-1-yl]butyl]benzamide |
| SMILES | CC(C)(C)c1cc(N2CCCN(CCCCNC(=O)c3ccc(Br)cc3)CC2)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C28H42BrN5O/c1-27(2,3)23-20-24(32-26(31-23)28(4,5)6)34-17-9-16-33(18-19-34)15-8-7-14-30-25(35)21-10-12-22(29)13-11-21/h10-13,20H,7-9,14-19H2,1-6H3,(H,30,35) |
| InChIKey | ZLTPEMJUHFAWFW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|