C25H37N7O — CID 86635175
N-[4-[4-(2-tert-butyl-6-cyclobutylpyrimidin-4-yl)piperazin-1-yl]butyl]pyridazine-4-carboxamide (PubChem CID 86635175) has the molecular formula C25H37N7O and a molecular weight of 451.62 g/mol. Its IUPAC name is N-[4-[4-(2-tert-butyl-6-cyclobutylpyrimidin-4-yl)piperazin-1-yl]butyl]pyridazine-4-carboxamide.
| Compound Name | N-[4-[4-(2-tert-butyl-6-cyclobutylpyrimidin-4-yl)piperazin-1-yl]butyl]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 86635175 |
| Molecular Formula | C25H37N7O |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.31 |
| IUPAC Name | N-[4-[4-(2-tert-butyl-6-cyclobutylpyrimidin-4-yl)piperazin-1-yl]butyl]pyridazine-4-carboxamide |
| SMILES | CC(C)(C)c1nc(C2CCC2)cc(N2CCN(CCCCNC(=O)c3ccnnc3)CC2)n1 |
| InChI | InChI=1S/C25H37N7O/c1-25(2,3)24-29-21(19-7-6-8-19)17-22(30-24)32-15-13-31(14-16-32)12-5-4-10-26-23(33)20-9-11-27-28-18-20/h9,11,17-19H,4-8,10,12-16H2,1-3H3,(H,26,33) |
| InChIKey | STWZRUYMHCGYEI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|