C25H38N6S — CID 69026630
2-tert-butyl-4-cyclobutyl-6-[4-[3-(1-cyclopropylpyrazol-3-yl)sulfanylpropyl]piperazin-1-yl]pyrimidine (PubChem CID 69026630) has the molecular formula C25H38N6S and a molecular weight of 454.69 g/mol. Its IUPAC name is 2-tert-butyl-4-cyclobutyl-6-[4-[3-(1-cyclopropylpyrazol-3-yl)sulfanylpropyl]piperazin-1-yl]pyrimidine.
| Compound Name | 2-tert-butyl-4-cyclobutyl-6-[4-[3-(1-cyclopropylpyrazol-3-yl)sulfanylpropyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 69026630 |
| Molecular Formula | C25H38N6S |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | 2-tert-butyl-4-cyclobutyl-6-[4-[3-(1-cyclopropylpyrazol-3-yl)sulfanylpropyl]piperazin-1-yl]pyrimidine |
| SMILES | CC(C)(C)c1nc(C2CCC2)cc(N2CCN(CCCSc3ccn(C4CC4)n3)CC2)n1 |
| InChI | InChI=1S/C25H38N6S/c1-25(2,3)24-26-21(19-6-4-7-19)18-22(27-24)30-15-13-29(14-16-30)11-5-17-32-23-10-12-31(28-23)20-8-9-20/h10,12,18-20H,4-9,11,13-17H2,1-3H3 |
| InChIKey | BAJFANIRKWCSBA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|