C27H38N6O5S — CID 69026636
but-2-enedioic acid;2-[3-[4-(2-tert-butyl-6-cyclobutylpyrimidin-4-yl)piperazin-1-yl]propylsulfanyl]-1H-pyrimidin-6-one (PubChem CID 69026636) has the molecular formula C27H38N6O5S and a molecular weight of 558.71 g/mol. Its IUPAC name is but-2-enedioic acid;2-[3-[4-(2-tert-butyl-6-cyclobutylpyrimidin-4-yl)piperazin-1-yl]propylsulfanyl]-1H-pyrimidin-6-one.
| Compound Name | but-2-enedioic acid;2-[3-[4-(2-tert-butyl-6-cyclobutylpyrimidin-4-yl)piperazin-1-yl]propylsulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 69026636 |
| Molecular Formula | C27H38N6O5S |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | but-2-enedioic acid;2-[3-[4-(2-tert-butyl-6-cyclobutylpyrimidin-4-yl)piperazin-1-yl]propylsulfanyl]-1H-pyrimidin-6-one |
| SMILES | CC(C)(C)c1nc(C2CCC2)cc(N2CCN(CCCSc3nccc(=O)[nH]3)CC2)n1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C23H34N6OS.C4H4O4/c1-23(2,3)21-25-18(17-6-4-7-17)16-19(26-21)29-13-11-28(12-14-29)10-5-15-31-22-24-9-8-20(30)27-22;5-3(6)1-2-4(7)8/h8-9,16-17H,4-7,10-15H2,1-3H3,(H,24,27,30);1-2H,(H,5,6)(H,7,8) |
| InChIKey | RGYRCWXLPOIIAY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 152.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|