C29H43N7O4S — CID 69027590
but-2-enedioic acid;2-tert-butyl-4-cyclobutyl-6-[4-[3-[(5-cyclopropyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperazin-1-yl]pyrimidine (PubChem CID 69027590) has the molecular formula C29H43N7O4S and a molecular weight of 585.78 g/mol. Its IUPAC name is but-2-enedioic acid;2-tert-butyl-4-cyclobutyl-6-[4-[3-[(5-cyclopropyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperazin-1-yl]pyrimidine.
| Compound Name | but-2-enedioic acid;2-tert-butyl-4-cyclobutyl-6-[4-[3-[(5-cyclopropyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 69027590 |
| Molecular Formula | C29H43N7O4S |
| Molecular Weight | 585.78 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | but-2-enedioic acid;2-tert-butyl-4-cyclobutyl-6-[4-[3-[(5-cyclopropyl-4-methyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperazin-1-yl]pyrimidine |
| SMILES | Cn1c(SCCCN2CCN(c3cc(C4CCC4)nc(C(C)(C)C)n3)CC2)nnc1C1CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C25H39N7S.C4H4O4/c1-25(2,3)23-26-20(18-7-5-8-18)17-21(27-23)32-14-12-31(13-15-32)11-6-16-33-24-29-28-22(30(24)4)19-9-10-19;5-3(6)1-2-4(7)8/h17-19H,5-16H2,1-4H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | IOMCYJBLGPIODN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 137.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.78 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|