C18H29ClN4 — CID 69026125
2-tert-butyl-4-[4-(3-chloropropyl)piperazin-1-yl]-6-cyclopropylpyrimidine (PubChem CID 69026125) has the molecular formula C18H29ClN4 and a molecular weight of 336.91 g/mol. Its IUPAC name is 2-tert-butyl-4-[4-(3-chloropropyl)piperazin-1-yl]-6-cyclopropylpyrimidine.
| Compound Name | 2-tert-butyl-4-[4-(3-chloropropyl)piperazin-1-yl]-6-cyclopropylpyrimidine |
|---|---|
| PubChem CID | 69026125 |
| Molecular Formula | C18H29ClN4 |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 2-tert-butyl-4-[4-(3-chloropropyl)piperazin-1-yl]-6-cyclopropylpyrimidine |
| SMILES | CC(C)(C)c1nc(C2CC2)cc(N2CCN(CCCCl)CC2)n1 |
| InChI | InChI=1S/C18H29ClN4/c1-18(2,3)17-20-15(14-5-6-14)13-16(21-17)23-11-9-22(10-12-23)8-4-7-19/h13-14H,4-12H2,1-3H3 |
| InChIKey | PIROTYIRRYNCRE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|