C48H64N12O4S2 — CID 87663799
bis[2-[3-[4-(2-tert-butyl-6-cyclopropylpyrimidin-4-yl)piperazin-1-yl]propylsulfanyl]pyrimidin-4-yl] (E)-but-2-enedioate (PubChem CID 87663799) has the molecular formula C48H64N12O4S2 and a molecular weight of 937.25 g/mol. Its IUPAC name is bis[2-[3-[4-(2-tert-butyl-6-cyclopropylpyrimidin-4-yl)piperazin-1-yl]propylsulfanyl]pyrimidin-4-yl] (E)-but-2-enedioate.
| Compound Name | bis[2-[3-[4-(2-tert-butyl-6-cyclopropylpyrimidin-4-yl)piperazin-1-yl]propylsulfanyl]pyrimidin-4-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 87663799 |
| Molecular Formula | C48H64N12O4S2 |
| Molecular Weight | 937.25 g/mol |
| Exact Mass | 936.46 |
| IUPAC Name | bis[2-[3-[4-(2-tert-butyl-6-cyclopropylpyrimidin-4-yl)piperazin-1-yl]propylsulfanyl]pyrimidin-4-yl] (E)-but-2-enedioate |
| SMILES | CC(C)(C)c1nc(C2CC2)cc(N2CCN(CCCSc3nccc(OC(=O)/C=C/C(=O)Oc4ccnc(SCCCN5CCN(c6cc(C7CC7)nc(C(C)(C)C)n6)CC5)n4)n3)CC2)n1 |
| InChI | InChI=1S/C48H64N12O4S2/c1-47(2,3)43-51-35(33-9-10-33)31-37(53-43)59-25-21-57(22-26-59)19-7-29-65-45-49-17-15-39(55-45)63-41(61)13-14-42(62)64-40-16-18-50-46(56-40)66-30-8-20-58-23-27-60(28-24-58)38-32-36(34-11-12-34)52-44(54-38)48(4,5)6/h13-18,31-34H,7-12,19-30H2,1-6H3/b14-13+ |
| InChIKey | LFWSPMSHGIYEJK-BUHFOSPRSA-N |
| XLogP | 6.87 |
| TPSA | 168.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.25 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|