C17H20Cl2N4OS — CID 22944048
2-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]propylsulfanyl]-1H-pyrimidin-6-one (PubChem CID 22944048) has the molecular formula C17H20Cl2N4OS and a molecular weight of 399.35 g/mol. Its IUPAC name is 2-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]propylsulfanyl]-1H-pyrimidin-6-one.
| Compound Name | 2-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]propylsulfanyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 22944048 |
| Molecular Formula | C17H20Cl2N4OS |
| Molecular Weight | 399.35 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 2-[3-[4-(3,5-dichlorophenyl)piperazin-1-yl]propylsulfanyl]-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(SCCCN2CCN(c3cc(Cl)cc(Cl)c3)CC2)[nH]1 |
| InChI | InChI=1S/C17H20Cl2N4OS/c18-13-10-14(19)12-15(11-13)23-7-5-22(6-8-23)4-1-9-25-17-20-3-2-16(24)21-17/h2-3,10-12H,1,4-9H2,(H,20,21,24) |
| InChIKey | XSPZNHMCOBHAPU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|