C17H21Cl2N5O2 — CID 139780419
2-[4-[4-(3,5-dichlorophenyl)piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione (PubChem CID 139780419) has the molecular formula C17H21Cl2N5O2 and a molecular weight of 398.29 g/mol. Its IUPAC name is 2-[4-[4-(3,5-dichlorophenyl)piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-[4-(3,5-dichlorophenyl)piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 139780419 |
| Molecular Formula | C17H21Cl2N5O2 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-[4-[4-(3,5-dichlorophenyl)piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(CCCCN2CCN(c3cc(Cl)cc(Cl)c3)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C17H21Cl2N5O2/c18-13-9-14(19)11-15(10-13)23-7-5-22(6-8-23)3-1-2-4-24-17(26)21-16(25)12-20-24/h9-12H,1-8H2,(H,21,25,26) |
| InChIKey | YJOSRQIEDYXQMJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|