C18H24IN5O2 — CID 54589053
2-[4-[4-(4-iodophenyl)piperazin-1-yl]butyl]-4-methyl-1,2,4-triazine-3,5-dione (PubChem CID 54589053) has the molecular formula C18H24IN5O2 and a molecular weight of 462.33 g/mol. Its IUPAC name is 2-[4-[4-(4-iodophenyl)piperazin-1-yl]butyl]-4-methyl-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-[4-(4-iodophenyl)piperazin-1-yl]butyl]-4-methyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 54589053 |
| Molecular Formula | C18H24IN5O2 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 2-[4-[4-(4-iodophenyl)piperazin-1-yl]butyl]-4-methyl-1,2,4-triazine-3,5-dione |
| SMILES | Cn1c(=O)cnn(CCCCN2CCN(c3ccc([120I])cc3)CC2)c1=O |
| InChI | InChI=1S/C18H24IN5O2/c1-21-17(25)14-20-24(18(21)26)9-3-2-8-22-10-12-23(13-11-22)16-6-4-15(19)5-7-16/h4-7,14H,2-3,8-13H2,1H3/i19-7 |
| InChIKey | LQNJXFPHBLYRNQ-FEMJQJFASA-N |
| XLogP | 1.15 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|