C16H25N7O2 — CID 67624195
4-methyl-2-[4-[4-(2H-pyrimidin-1-yl)piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione (PubChem CID 67624195) has the molecular formula C16H25N7O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 4-methyl-2-[4-[4-(2H-pyrimidin-1-yl)piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 4-methyl-2-[4-[4-(2H-pyrimidin-1-yl)piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 67624195 |
| Molecular Formula | C16H25N7O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 4-methyl-2-[4-[4-(2H-pyrimidin-1-yl)piperazin-1-yl]butyl]-1,2,4-triazine-3,5-dione |
| SMILES | Cn1c(=O)cnn(CCCCN2CCN(N3C=CC=NC3)CC2)c1=O |
| InChI | InChI=1S/C16H25N7O2/c1-19-15(24)13-18-23(16(19)25)8-3-2-6-20-9-11-21(12-10-20)22-7-4-5-17-14-22/h4-5,7,13H,2-3,6,8-12,14H2,1H3 |
| InChIKey | NELKFDHSONDYTM-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 78.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|