C25H24N2O7S — CID 18315465
ethyl 3-[3-[2-(benzenesulfonylmethyl)phenyl]propanoylamino]-4-nitrobenzoate (PubChem CID 18315465) has the molecular formula C25H24N2O7S and a molecular weight of 496.54 g/mol. Its IUPAC name is ethyl 3-[3-[2-(benzenesulfonylmethyl)phenyl]propanoylamino]-4-nitrobenzoate.
| Compound Name | ethyl 3-[3-[2-(benzenesulfonylmethyl)phenyl]propanoylamino]-4-nitrobenzoate |
|---|---|
| PubChem CID | 18315465 |
| Molecular Formula | C25H24N2O7S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | ethyl 3-[3-[2-(benzenesulfonylmethyl)phenyl]propanoylamino]-4-nitrobenzoate |
| SMILES | CCOC(=O)c1ccc([N+](=O)[O-])c(NC(=O)CCc2ccccc2CS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H24N2O7S/c1-2-34-25(29)19-12-14-23(27(30)31)22(16-19)26-24(28)15-13-18-8-6-7-9-20(18)17-35(32,33)21-10-4-3-5-11-21/h3-12,14,16H,2,13,15,17H2,1H3,(H,26,28) |
| InChIKey | SIWCAAFQERMXAH-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|