C28H29FN4O2S — CID 18315792
[2-[2-(4-fluoroanilino)-5,6-dimethylpyrimidin-4-yl]-1-methyl-3,4-dihydro-1H-isoquinolin-7-yl] acetate;thiophene (PubChem CID 18315792) has the molecular formula C28H29FN4O2S and a molecular weight of 504.63 g/mol. Its IUPAC name is [2-[2-(4-fluoroanilino)-5,6-dimethylpyrimidin-4-yl]-1-methyl-3,4-dihydro-1H-isoquinolin-7-yl] acetate;thiophene.
| Compound Name | [2-[2-(4-fluoroanilino)-5,6-dimethylpyrimidin-4-yl]-1-methyl-3,4-dihydro-1H-isoquinolin-7-yl] acetate;thiophene |
|---|---|
| PubChem CID | 18315792 |
| Molecular Formula | C28H29FN4O2S |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | [2-[2-(4-fluoroanilino)-5,6-dimethylpyrimidin-4-yl]-1-methyl-3,4-dihydro-1H-isoquinolin-7-yl] acetate;thiophene |
| SMILES | CC(=O)Oc1ccc2c(c1)C(C)N(c1nc(Nc3ccc(F)cc3)nc(C)c1C)CC2.c1ccsc1 |
| InChI | InChI=1S/C24H25FN4O2.C4H4S/c1-14-15(2)26-24(27-20-8-6-19(25)7-9-20)28-23(14)29-12-11-18-5-10-21(31-17(4)30)13-22(18)16(29)3;1-2-4-5-3-1/h5-10,13,16H,11-12H2,1-4H3,(H,26,27,28);1-4H |
| InChIKey | SIRBUGXJRBDBQQ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|