C23H28N6O3 — CID 18318220
3-[(E)-3-[4-(1-ethanimidoylpiperidin-4-yl)oxy-3-nitroanilino]prop-1-enyl]benzenecarboximidamide (PubChem CID 18318220) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is 3-[(E)-3-[4-(1-ethanimidoylpiperidin-4-yl)oxy-3-nitroanilino]prop-1-enyl]benzenecarboximidamide.
| Compound Name | 3-[(E)-3-[4-(1-ethanimidoylpiperidin-4-yl)oxy-3-nitroanilino]prop-1-enyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 18318220 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 3-[(E)-3-[4-(1-ethanimidoylpiperidin-4-yl)oxy-3-nitroanilino]prop-1-enyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(/C=C/CNc2ccc(OC3CCN(/C(C)=N/[H])CC3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C23H28N6O3/c1-16(24)28-12-9-20(10-13-28)32-22-8-7-19(15-21(22)29(30)31)27-11-3-5-17-4-2-6-18(14-17)23(25)26/h2-8,14-15,20,24,27H,9-13H2,1H3,(H3,25,26)/b5-3+,24-16+ |
| InChIKey | YNYVXZDENRCRMJ-WAHZRSDSSA-N |
| XLogP | 3.84 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|