C12H14F6N2O2 — CID 18322621
1,1,1-trifluoro-5-[2-[(5,5,5-trifluoro-3-oxopentylidene)amino]ethylimino]pentan-3-one (PubChem CID 18322621) has the molecular formula C12H14F6N2O2 and a molecular weight of 332.24 g/mol. Its IUPAC name is 1,1,1-trifluoro-5-[2-[(5,5,5-trifluoro-3-oxopentylidene)amino]ethylimino]pentan-3-one.
| Compound Name | 1,1,1-trifluoro-5-[2-[(5,5,5-trifluoro-3-oxopentylidene)amino]ethylimino]pentan-3-one |
|---|---|
| PubChem CID | 18322621 |
| Molecular Formula | C12H14F6N2O2 |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1,1,1-trifluoro-5-[2-[(5,5,5-trifluoro-3-oxopentylidene)amino]ethylimino]pentan-3-one |
| SMILES | O=C(C/C=N/CC/N=C/CC(=O)CC(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C12H14F6N2O2/c13-11(14,15)7-9(21)1-3-19-5-6-20-4-2-10(22)8-12(16,17)18/h3-4H,1-2,5-8H2/b19-3+,20-4+ |
| InChIKey | FPZNXBNXDKESPT-KNPOPJAVSA-N |
| XLogP | 2.95 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|