C12H14F6N2O2 — CID 597142
5,5,5-trifluoro-4-[2-[(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]ethylimino]pentan-2-one (PubChem CID 597142) has the molecular formula C12H14F6N2O2 and a molecular weight of 332.24 g/mol. Its IUPAC name is 5,5,5-trifluoro-4-[2-[(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]ethylimino]pentan-2-one.
| Compound Name | 5,5,5-trifluoro-4-[2-[(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]ethylimino]pentan-2-one |
|---|---|
| PubChem CID | 597142 |
| Molecular Formula | C12H14F6N2O2 |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 5,5,5-trifluoro-4-[2-[(1,1,1-trifluoro-4-oxopentan-2-ylidene)amino]ethylimino]pentan-2-one |
| SMILES | CC(=O)C/C(=N\CC/N=C(\CC(C)=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H14F6N2O2/c1-7(21)5-9(11(13,14)15)19-3-4-20-10(6-8(2)22)12(16,17)18/h3-6H2,1-2H3/b19-9+,20-10+ |
| InChIKey | QBKKVUCATRKLAI-LQGKIZFRSA-N |
| XLogP | 2.95 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|