C8H11F4NO — CID 125487257
1,1,5,5-tetrafluoro-3-propan-2-yliminopentan-2-one (PubChem CID 125487257) has the molecular formula C8H11F4NO and a molecular weight of 213.17 g/mol. Its IUPAC name is 1,1,5,5-tetrafluoro-3-propan-2-yliminopentan-2-one.
| Compound Name | 1,1,5,5-tetrafluoro-3-propan-2-yliminopentan-2-one |
|---|---|
| PubChem CID | 125487257 |
| Molecular Formula | C8H11F4NO |
| Molecular Weight | 213.17 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 1,1,5,5-tetrafluoro-3-propan-2-yliminopentan-2-one |
| SMILES | CC(C)/N=C(\CC(F)F)C(=O)C(F)F |
| InChI | InChI=1S/C8H11F4NO/c1-4(2)13-5(3-6(9)10)7(14)8(11)12/h4,6,8H,3H2,1-2H3/b13-5+ |
| InChIKey | HHBBMUGAISGKHH-WLRTZDKTSA-N |
| XLogP | 2.33 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.17 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|