C12H8F12N2O2 — CID 102157491
1,1,1,5,5,5-hexafluoro-4-[2-[(1,1,1,5,5,5-hexafluoro-4-oxopentan-2-ylidene)amino]ethylimino]pentan-2-one (PubChem CID 102157491) has the molecular formula C12H8F12N2O2 and a molecular weight of 440.18 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-4-[2-[(1,1,1,5,5,5-hexafluoro-4-oxopentan-2-ylidene)amino]ethylimino]pentan-2-one.
| Compound Name | 1,1,1,5,5,5-hexafluoro-4-[2-[(1,1,1,5,5,5-hexafluoro-4-oxopentan-2-ylidene)amino]ethylimino]pentan-2-one |
|---|---|
| PubChem CID | 102157491 |
| Molecular Formula | C12H8F12N2O2 |
| Molecular Weight | 440.18 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-4-[2-[(1,1,1,5,5,5-hexafluoro-4-oxopentan-2-ylidene)amino]ethylimino]pentan-2-one |
| SMILES | O=C(C/C(=N\CC/N=C(\CC(=O)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H8F12N2O2/c13-9(14,15)5(3-7(27)11(19,20)21)25-1-2-26-6(10(16,17)18)4-8(28)12(22,23)24/h1-4H2/b25-5+,26-6+ |
| InChIKey | ZQSQPAWMRDQANI-GQBJSJAWSA-N |
| XLogP | 4.04 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.18 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|