C28H40Cl2IN3O4 — CID 18323938
1-[1-[4-[(3,4-dichlorophenyl)methyl]-1-methylpiperidin-1-ium-1-yl]-3-methylbutan-2-yl]-3-(3,4,5-trimethoxyphenyl)urea iodide (PubChem CID 18323938) has the molecular formula C28H40Cl2IN3O4 and a molecular weight of 680.46 g/mol. Its IUPAC name is 1-[1-[4-[(3,4-dichlorophenyl)methyl]-1-methylpiperidin-1-ium-1-yl]-3-methylbutan-2-yl]-3-(3,4,5-trimethoxyphenyl)urea iodide.
| Compound Name | 1-[1-[4-[(3,4-dichlorophenyl)methyl]-1-methylpiperidin-1-ium-1-yl]-3-methylbutan-2-yl]-3-(3,4,5-trimethoxyphenyl)urea iodide |
|---|---|
| PubChem CID | 18323938 |
| Molecular Formula | C28H40Cl2IN3O4 |
| Molecular Weight | 680.46 g/mol |
| Exact Mass | 679.14 |
| IUPAC Name | 1-[1-[4-[(3,4-dichlorophenyl)methyl]-1-methylpiperidin-1-ium-1-yl]-3-methylbutan-2-yl]-3-(3,4,5-trimethoxyphenyl)urea iodide |
| SMILES | COc1cc(NC(=O)NC(C[N+]2(C)CCC(Cc3ccc(Cl)c(Cl)c3)CC2)C(C)C)cc(OC)c1OC.[I-] |
| InChI | InChI=1S/C28H39Cl2N3O4.HI/c1-18(2)24(32-28(34)31-21-15-25(35-4)27(37-6)26(16-21)36-5)17-33(3)11-9-19(10-12-33)13-20-7-8-22(29)23(30)14-20;/h7-8,14-16,18-19,24H,9-13,17H2,1-6H3,(H-,31,32,34);1H |
| InChIKey | NZTAAOBSYNRLHM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|