C29H42Cl2N3O4+ — CID 54484163
[1-[4-[(3,4-dichlorophenyl)methyl]-1-ethylpiperidin-1-ium-1-yl]-3-methyl-3-(3,4,5-trimethoxyphenyl)butan-2-yl]urea (PubChem CID 54484163) has the molecular formula C29H42Cl2N3O4+ and a molecular weight of 567.58 g/mol. Its IUPAC name is [1-[4-[(3,4-dichlorophenyl)methyl]-1-ethylpiperidin-1-ium-1-yl]-3-methyl-3-(3,4,5-trimethoxyphenyl)butan-2-yl]urea.
| Compound Name | [1-[4-[(3,4-dichlorophenyl)methyl]-1-ethylpiperidin-1-ium-1-yl]-3-methyl-3-(3,4,5-trimethoxyphenyl)butan-2-yl]urea |
|---|---|
| PubChem CID | 54484163 |
| Molecular Formula | C29H42Cl2N3O4+ |
| Molecular Weight | 567.58 g/mol |
| Exact Mass | 566.25 |
| IUPAC Name | [1-[4-[(3,4-dichlorophenyl)methyl]-1-ethylpiperidin-1-ium-1-yl]-3-methyl-3-(3,4,5-trimethoxyphenyl)butan-2-yl]urea |
| SMILES | CC[N+]1(CC(NC(N)=O)C(C)(C)c2cc(OC)c(OC)c(OC)c2)CCC(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C29H41Cl2N3O4/c1-7-34(12-10-19(11-13-34)14-20-8-9-22(30)23(31)15-20)18-26(33-28(32)35)29(2,3)21-16-24(36-4)27(38-6)25(17-21)37-5/h8-9,15-17,19,26H,7,10-14,18H2,1-6H3,(H2-,32,33,35)/p+1 |
| InChIKey | XRCQZOUZRBTGJW-UHFFFAOYSA-O |
| XLogP | 5.82 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.58 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|