C27H38Cl2N3O+ — CID 69258016
4-(2-aminoethyl)-N-[(2S)-1-[4-[(3,4-dichlorophenyl)methyl]-1-methylpiperidin-1-ium-1-yl]-3-methylbutan-2-yl]benzamide (PubChem CID 69258016) has the molecular formula C27H38Cl2N3O+ and a molecular weight of 491.53 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N-[(2S)-1-[4-[(3,4-dichlorophenyl)methyl]-1-methylpiperidin-1-ium-1-yl]-3-methylbutan-2-yl]benzamide.
| Compound Name | 4-(2-aminoethyl)-N-[(2S)-1-[4-[(3,4-dichlorophenyl)methyl]-1-methylpiperidin-1-ium-1-yl]-3-methylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 69258016 |
| Molecular Formula | C27H38Cl2N3O+ |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 4-(2-aminoethyl)-N-[(2S)-1-[4-[(3,4-dichlorophenyl)methyl]-1-methylpiperidin-1-ium-1-yl]-3-methylbutan-2-yl]benzamide |
| SMILES | CC(C)[C@@H](C[N+]1(C)CCC(Cc2ccc(Cl)c(Cl)c2)CC1)NC(=O)c1ccc(CCN)cc1 |
| InChI | InChI=1S/C27H37Cl2N3O/c1-19(2)26(31-27(33)23-7-4-20(5-8-23)10-13-30)18-32(3)14-11-21(12-15-32)16-22-6-9-24(28)25(29)17-22/h4-9,17,19,21,26H,10-16,18,30H2,1-3H3/p+1/t21?,26-,32?/m1/s1 |
| InChIKey | PTRIDTYHCDFYEI-GYNGIDKBSA-O |
| XLogP | 5.35 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|