C19H32N2O5S — CID 18325433
2-[(2-ethoxyphenyl)methyl-octylsulfonylamino]-N-hydroxyacetamide (PubChem CID 18325433) has the molecular formula C19H32N2O5S and a molecular weight of 400.54 g/mol. Its IUPAC name is 2-[(2-ethoxyphenyl)methyl-octylsulfonylamino]-N-hydroxyacetamide.
| Compound Name | 2-[(2-ethoxyphenyl)methyl-octylsulfonylamino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 18325433 |
| Molecular Formula | C19H32N2O5S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-[(2-ethoxyphenyl)methyl-octylsulfonylamino]-N-hydroxyacetamide |
| SMILES | CCCCCCCCS(=O)(=O)N(CC(=O)NO)Cc1ccccc1OCC |
| InChI | InChI=1S/C19H32N2O5S/c1-3-5-6-7-8-11-14-27(24,25)21(16-19(22)20-23)15-17-12-9-10-13-18(17)26-4-2/h9-10,12-13,23H,3-8,11,14-16H2,1-2H3,(H,20,22) |
| InChIKey | SZUBKECHPDTJKS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|