C32H37N5O5 — CID 18329654
tert-butyl 4-[4-[(7-cyanonaphthalen-2-yl)methyl-(ethoxycarbonylcarbamoyl)amino]phenyl]-1,4-diazepane-1-carboxylate (PubChem CID 18329654) has the molecular formula C32H37N5O5 and a molecular weight of 571.68 g/mol. Its IUPAC name is tert-butyl 4-[4-[(7-cyanonaphthalen-2-yl)methyl-(ethoxycarbonylcarbamoyl)amino]phenyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(7-cyanonaphthalen-2-yl)methyl-(ethoxycarbonylcarbamoyl)amino]phenyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 18329654 |
| Molecular Formula | C32H37N5O5 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | tert-butyl 4-[4-[(7-cyanonaphthalen-2-yl)methyl-(ethoxycarbonylcarbamoyl)amino]phenyl]-1,4-diazepane-1-carboxylate |
| SMILES | CCOC(=O)NC(=O)N(Cc1ccc2ccc(C#N)cc2c1)c1ccc(N2CCCN(C(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C32H37N5O5/c1-5-41-30(39)34-29(38)37(22-24-8-10-25-9-7-23(21-33)19-26(25)20-24)28-13-11-27(12-14-28)35-15-6-16-36(18-17-35)31(40)42-32(2,3)4/h7-14,19-20H,5-6,15-18,22H2,1-4H3,(H,34,38,39) |
| InChIKey | UVQIZZSACRTXJM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|