C4H10O3S — CID 18330
2-(2-hydroxyethylsulfinyl)ethanol (PubChem CID 18330) has the molecular formula C4H10O3S and a molecular weight of 138.19 g/mol. Its IUPAC name is 2-(2-hydroxyethylsulfinyl)ethanol.
| Compound Name | 2-(2-hydroxyethylsulfinyl)ethanol |
|---|---|
| PubChem CID | 18330 |
| Molecular Formula | C4H10O3S |
| Molecular Weight | 138.19 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 2-(2-hydroxyethylsulfinyl)ethanol |
| SMILES | O=S(CCO)CCO |
| InChI | InChI=1S/C4H10O3S/c5-1-3-8(7)4-2-6/h5-6H,1-4H2 |
| InChIKey | XHKPPUVICXLDRJ-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.19 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |