C17H19NOS — CID 18331726
N-[3-(4-methylpent-1-en-2-yl)thiophen-2-yl]benzamide (PubChem CID 18331726) has the molecular formula C17H19NOS and a molecular weight of 285.41 g/mol. Its IUPAC name is N-[3-(4-methylpent-1-en-2-yl)thiophen-2-yl]benzamide.
| Compound Name | N-[3-(4-methylpent-1-en-2-yl)thiophen-2-yl]benzamide |
|---|---|
| PubChem CID | 18331726 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-[3-(4-methylpent-1-en-2-yl)thiophen-2-yl]benzamide |
| SMILES | C=C(CC(C)C)c1ccsc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H19NOS/c1-12(2)11-13(3)15-9-10-20-17(15)18-16(19)14-7-5-4-6-8-14/h4-10,12H,3,11H2,1-2H3,(H,18,19) |
| InChIKey | DKIZGNPQHPPPOX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |