C19H18F2N2S — CID 18334203
3-[[1-(3,4-difluorophenyl)ethylamino]-thiophen-2-ylmethyl]aniline (PubChem CID 18334203) has the molecular formula C19H18F2N2S and a molecular weight of 344.43 g/mol. Its IUPAC name is 3-[[1-(3,4-difluorophenyl)ethylamino]-thiophen-2-ylmethyl]aniline.
| Compound Name | 3-[[1-(3,4-difluorophenyl)ethylamino]-thiophen-2-ylmethyl]aniline |
|---|---|
| PubChem CID | 18334203 |
| Molecular Formula | C19H18F2N2S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 3-[[1-(3,4-difluorophenyl)ethylamino]-thiophen-2-ylmethyl]aniline |
| SMILES | CC(NC(c1cccc(N)c1)c1cccs1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H18F2N2S/c1-12(13-7-8-16(20)17(21)11-13)23-19(18-6-3-9-24-18)14-4-2-5-15(22)10-14/h2-12,19,23H,22H2,1H3 |
| InChIKey | UXNUMFUBVOUQDB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|