C20H18F2N2O2S — CID 18334253
1-(3,4-difluorophenyl)-N-[(4-methylthiophen-2-yl)-(3-nitrophenyl)methyl]ethanamine (PubChem CID 18334253) has the molecular formula C20H18F2N2O2S and a molecular weight of 388.44 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N-[(4-methylthiophen-2-yl)-(3-nitrophenyl)methyl]ethanamine.
| Compound Name | 1-(3,4-difluorophenyl)-N-[(4-methylthiophen-2-yl)-(3-nitrophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 18334253 |
| Molecular Formula | C20H18F2N2O2S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N-[(4-methylthiophen-2-yl)-(3-nitrophenyl)methyl]ethanamine |
| SMILES | Cc1csc(C(NC(C)c2ccc(F)c(F)c2)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C20H18F2N2O2S/c1-12-8-19(27-11-12)20(15-4-3-5-16(9-15)24(25)26)23-13(2)14-6-7-17(21)18(22)10-14/h3-11,13,20,23H,1-2H3 |
| InChIKey | MLEMZTSQXPJNHA-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|