C20H22N2OS — CID 18334617
3-(1,2-dimethyl-5-oxophenothiazin-10-yl)-N-prop-2-ynylpropan-1-amine (PubChem CID 18334617) has the molecular formula C20H22N2OS and a molecular weight of 338.48 g/mol. Its IUPAC name is 3-(1,2-dimethyl-5-oxophenothiazin-10-yl)-N-prop-2-ynylpropan-1-amine.
| Compound Name | 3-(1,2-dimethyl-5-oxophenothiazin-10-yl)-N-prop-2-ynylpropan-1-amine |
|---|---|
| PubChem CID | 18334617 |
| Molecular Formula | C20H22N2OS |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 3-(1,2-dimethyl-5-oxophenothiazin-10-yl)-N-prop-2-ynylpropan-1-amine |
| SMILES | C#CCNCCCN1c2ccccc2S(=O)c2ccc(C)c(C)c21 |
| InChI | InChI=1S/C20H22N2OS/c1-4-12-21-13-7-14-22-17-8-5-6-9-18(17)24(23)19-11-10-15(2)16(3)20(19)22/h1,5-6,8-11,21H,7,12-14H2,2-3H3 |
| InChIKey | MMHHUKWBZBYLQG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|