C26H28N2O3S — CID 18334608
methyl 10-[3-(benzylamino)propyl]-8,9-dimethyl-5-oxophenothiazine-4-carboxylate (PubChem CID 18334608) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is methyl 10-[3-(benzylamino)propyl]-8,9-dimethyl-5-oxophenothiazine-4-carboxylate.
| Compound Name | methyl 10-[3-(benzylamino)propyl]-8,9-dimethyl-5-oxophenothiazine-4-carboxylate |
|---|---|
| PubChem CID | 18334608 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | methyl 10-[3-(benzylamino)propyl]-8,9-dimethyl-5-oxophenothiazine-4-carboxylate |
| SMILES | COC(=O)c1cccc2c1S(=O)c1ccc(C)c(C)c1N2CCCNCc1ccccc1 |
| InChI | InChI=1S/C26H28N2O3S/c1-18-13-14-23-24(19(18)2)28(16-8-15-27-17-20-9-5-4-6-10-20)22-12-7-11-21(26(29)31-3)25(22)32(23)30/h4-7,9-14,27H,8,15-17H2,1-3H3 |
| InChIKey | UIEFPPGCSLQJBC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|