C21H26N2O5S — CID 20715046
2-[2,2-dihydroxyethyl-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]amino]acetic acid (PubChem CID 20715046) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is 2-[2,2-dihydroxyethyl-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]amino]acetic acid.
| Compound Name | 2-[2,2-dihydroxyethyl-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]amino]acetic acid |
|---|---|
| PubChem CID | 20715046 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 2-[2,2-dihydroxyethyl-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]amino]acetic acid |
| SMILES | Cc1ccc2c(c1C)N(CCCN(CC(=O)O)CC(O)O)c1ccccc1S2=O |
| InChI | InChI=1S/C21H26N2O5S/c1-14-8-9-18-21(15(14)2)23(16-6-3-4-7-17(16)29(18)28)11-5-10-22(12-19(24)25)13-20(26)27/h3-4,6-9,19,24-25H,5,10-13H2,1-2H3,(H,26,27) |
| InChIKey | CXRPDZDSFVHISI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|