C26H30N2O3S — CID 20715049
2-[benzyl-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]amino]ethane-1,1-diol (PubChem CID 20715049) has the molecular formula C26H30N2O3S and a molecular weight of 450.60 g/mol. Its IUPAC name is 2-[benzyl-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]amino]ethane-1,1-diol.
| Compound Name | 2-[benzyl-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]amino]ethane-1,1-diol |
|---|---|
| PubChem CID | 20715049 |
| Molecular Formula | C26H30N2O3S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 2-[benzyl-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]amino]ethane-1,1-diol |
| SMILES | Cc1ccc2c(c1C)N(CCCN(Cc1ccccc1)CC(O)O)c1ccccc1S2=O |
| InChI | InChI=1S/C26H30N2O3S/c1-19-13-14-24-26(20(19)2)28(22-11-6-7-12-23(22)32(24)31)16-8-15-27(18-25(29)30)17-21-9-4-3-5-10-21/h3-7,9-14,25,29-30H,8,15-18H2,1-2H3 |
| InChIKey | MPFWMEWIZTYLPP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|