C17H19ClN2OS — CID 18334572
3-(8-chloro-1,2-dimethyl-5-oxophenothiazin-10-yl)propan-1-amine (PubChem CID 18334572) has the molecular formula C17H19ClN2OS and a molecular weight of 334.87 g/mol. Its IUPAC name is 3-(8-chloro-1,2-dimethyl-5-oxophenothiazin-10-yl)propan-1-amine.
| Compound Name | 3-(8-chloro-1,2-dimethyl-5-oxophenothiazin-10-yl)propan-1-amine |
|---|---|
| PubChem CID | 18334572 |
| Molecular Formula | C17H19ClN2OS |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 3-(8-chloro-1,2-dimethyl-5-oxophenothiazin-10-yl)propan-1-amine |
| SMILES | Cc1ccc2c(c1C)N(CCCN)c1cc(Cl)ccc1S2=O |
| InChI | InChI=1S/C17H19ClN2OS/c1-11-4-6-16-17(12(11)2)20(9-3-8-19)14-10-13(18)5-7-15(14)22(16)21/h4-7,10H,3,8-9,19H2,1-2H3 |
| InChIKey | PLVIUIOSMLJDPW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |