C25H22N2O3S — CID 12052205
2-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]isoindole-1,3-dione (PubChem CID 12052205) has the molecular formula C25H22N2O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 12052205 |
| Molecular Formula | C25H22N2O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 2-[3-(1,2-dimethyl-5-oxophenothiazin-10-yl)propyl]isoindole-1,3-dione |
| SMILES | Cc1ccc2c(c1C)N(CCCN1C(=O)c3ccccc3C1=O)c1ccccc1S2=O |
| InChI | InChI=1S/C25H22N2O3S/c1-16-12-13-22-23(17(16)2)26(20-10-5-6-11-21(20)31(22)30)14-7-15-27-24(28)18-8-3-4-9-19(18)25(27)29/h3-6,8-13H,7,14-15H2,1-2H3 |
| InChIKey | LBJWGVUDGRHZPZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|