C27H32N2O3S — CID 20715059
N-benzyl-3-[1,2-dimethyl-6-(2-methylperoxyethyl)-5-oxophenothiazin-10-yl]propan-1-amine (PubChem CID 20715059) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is N-benzyl-3-[1,2-dimethyl-6-(2-methylperoxyethyl)-5-oxophenothiazin-10-yl]propan-1-amine.
| Compound Name | N-benzyl-3-[1,2-dimethyl-6-(2-methylperoxyethyl)-5-oxophenothiazin-10-yl]propan-1-amine |
|---|---|
| PubChem CID | 20715059 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N-benzyl-3-[1,2-dimethyl-6-(2-methylperoxyethyl)-5-oxophenothiazin-10-yl]propan-1-amine |
| SMILES | COOCCc1cccc2c1S(=O)c1ccc(C)c(C)c1N2CCCNCc1ccccc1 |
| InChI | InChI=1S/C27H32N2O3S/c1-20-13-14-25-26(21(20)2)29(17-8-16-28-19-22-9-5-4-6-10-22)24-12-7-11-23(15-18-32-31-3)27(24)33(25)30/h4-7,9-14,28H,8,15-19H2,1-3H3 |
| InChIKey | QGFCVMLEDDSGPG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|