C20H31FN2 — CID 18335090
1-[(4-tert-butylpyrrolidin-3-yl)methyl]-4-(4-fluorophenyl)piperidine (PubChem CID 18335090) has the molecular formula C20H31FN2 and a molecular weight of 318.48 g/mol. Its IUPAC name is 1-[(4-tert-butylpyrrolidin-3-yl)methyl]-4-(4-fluorophenyl)piperidine.
| Compound Name | 1-[(4-tert-butylpyrrolidin-3-yl)methyl]-4-(4-fluorophenyl)piperidine |
|---|---|
| PubChem CID | 18335090 |
| Molecular Formula | C20H31FN2 |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | 1-[(4-tert-butylpyrrolidin-3-yl)methyl]-4-(4-fluorophenyl)piperidine |
| SMILES | CC(C)(C)C1CNCC1CN1CCC(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H31FN2/c1-20(2,3)19-13-22-12-17(19)14-23-10-8-16(9-11-23)15-4-6-18(21)7-5-15/h4-7,16-17,19,22H,8-14H2,1-3H3 |
| InChIKey | MHADYCBWTKYOPS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |