C17H23NO3 — CID 18335577
ethyl 5-benzyl-6-hydroxy-2-azabicyclo[2.2.2]octane-2-carboxylate (PubChem CID 18335577) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is ethyl 5-benzyl-6-hydroxy-2-azabicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | ethyl 5-benzyl-6-hydroxy-2-azabicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 18335577 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethyl 5-benzyl-6-hydroxy-2-azabicyclo[2.2.2]octane-2-carboxylate |
| SMILES | CCOC(=O)N1CC2CCC1C(O)C2Cc1ccccc1 |
| InChI | InChI=1S/C17H23NO3/c1-2-21-17(20)18-11-13-8-9-15(18)16(19)14(13)10-12-6-4-3-5-7-12/h3-7,13-16,19H,2,8-11H2,1H3 |
| InChIKey | ODZLFHXUTHKWQL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |