C17H24N2O2 — CID 162385076
ethyl (3aS,4R,6aS)-1-benzyl-4-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate (PubChem CID 162385076) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is ethyl (3aS,4R,6aS)-1-benzyl-4-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate.
| Compound Name | ethyl (3aS,4R,6aS)-1-benzyl-4-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 162385076 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | ethyl (3aS,4R,6aS)-1-benzyl-4-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)N1C[C@@H]2[C@@H](CCN2Cc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C17H24N2O2/c1-3-21-17(20)19-12-16-15(13(19)2)9-10-18(16)11-14-7-5-4-6-8-14/h4-8,13,15-16H,3,9-12H2,1-2H3/t13-,15+,16-/m1/s1 |
| InChIKey | KNGZLYTYXDDEGZ-VNQPRFMTSA-N |
| XLogP | 2.74 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |