C7H17BN2O4 — CID 18335775
N-[3-(1,3-dihydroxypropan-2-ylamino)-3-oxopropyl]-methylboronamidic acid (PubChem CID 18335775) has the molecular formula C7H17BN2O4 and a molecular weight of 204.03 g/mol. Its IUPAC name is N-[3-(1,3-dihydroxypropan-2-ylamino)-3-oxopropyl]-methylboronamidic acid.
| Compound Name | N-[3-(1,3-dihydroxypropan-2-ylamino)-3-oxopropyl]-methylboronamidic acid |
|---|---|
| PubChem CID | 18335775 |
| Molecular Formula | C7H17BN2O4 |
| Molecular Weight | 204.03 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N-[3-(1,3-dihydroxypropan-2-ylamino)-3-oxopropyl]-methylboronamidic acid |
| SMILES | CB(O)NCCC(=O)NC(CO)CO |
| InChI | InChI=1S/C7H17BN2O4/c1-8(14)9-3-2-7(13)10-6(4-11)5-12/h6,9,11-12,14H,2-5H2,1H3,(H,10,13) |
| InChIKey | RONJTLPZTBLQFS-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.03 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|