C9H18N2O6 — CID 91140393
N,N'-bis(1,3-dihydroxypropan-2-yl)propanediamide (PubChem CID 91140393) has the molecular formula C9H18N2O6 and a molecular weight of 250.25 g/mol. Its IUPAC name is N,N'-bis(1,3-dihydroxypropan-2-yl)propanediamide.
| Compound Name | N,N'-bis(1,3-dihydroxypropan-2-yl)propanediamide |
|---|---|
| PubChem CID | 91140393 |
| Molecular Formula | C9H18N2O6 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | N,N'-bis(1,3-dihydroxypropan-2-yl)propanediamide |
| SMILES | O=C(CC(=O)NC(CO)CO)NC(CO)CO |
| InChI | InChI=1S/C9H18N2O6/c12-2-6(3-13)10-8(16)1-9(17)11-7(4-14)5-15/h6-7,12-15H,1-5H2,(H,10,16)(H,11,17) |
| InChIKey | BJBITEMWBACZKN-UHFFFAOYSA-N |
| XLogP | -3.68 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|