C24H38O3 — CID 18336236
(1-ethylcyclopentyl) 3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-3-hydroxypropanoate (PubChem CID 18336236) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is (1-ethylcyclopentyl) 3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-3-hydroxypropanoate.
| Compound Name | (1-ethylcyclopentyl) 3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 18336236 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | (1-ethylcyclopentyl) 3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-3-hydroxypropanoate |
| SMILES | CCC1(OC(=O)CC(O)C2CC3CC2C2C4CC(C(C)C4C)C32)CCCC1 |
| InChI | InChI=1S/C24H38O3/c1-4-24(7-5-6-8-24)27-21(26)12-20(25)18-9-15-10-19(18)23-17-11-16(22(15)23)13(2)14(17)3/h13-20,22-23,25H,4-12H2,1-3H3 |
| InChIKey | DRCFTYXGMYXZTB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|