C25H40O3 — CID 18336237
(1-ethylcyclohexyl) 3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-3-hydroxypropanoate (PubChem CID 18336237) has the molecular formula C25H40O3 and a molecular weight of 388.59 g/mol. Its IUPAC name is (1-ethylcyclohexyl) 3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-3-hydroxypropanoate.
| Compound Name | (1-ethylcyclohexyl) 3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 18336237 |
| Molecular Formula | C25H40O3 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 388.30 |
| IUPAC Name | (1-ethylcyclohexyl) 3-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-3-hydroxypropanoate |
| SMILES | CCC1(OC(=O)CC(O)C2CC3CC2C2C4CC(C(C)C4C)C32)CCCCC1 |
| InChI | InChI=1S/C25H40O3/c1-4-25(8-6-5-7-9-25)28-22(27)13-21(26)19-10-16-11-20(19)24-18-12-17(23(16)24)14(2)15(18)3/h14-21,23-24,26H,4-13H2,1-3H3 |
| InChIKey | ORZJBCYKUCJWLV-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|