C18H22N4O2S2 — CID 18336605
4-[(2-sulfanylanilino)oxymethyl]-N-(2-sulfanylphenyl)piperazine-1-carboxamide (PubChem CID 18336605) has the molecular formula C18H22N4O2S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 4-[(2-sulfanylanilino)oxymethyl]-N-(2-sulfanylphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[(2-sulfanylanilino)oxymethyl]-N-(2-sulfanylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 18336605 |
| Molecular Formula | C18H22N4O2S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 4-[(2-sulfanylanilino)oxymethyl]-N-(2-sulfanylphenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1S)N1CCN(CONc2ccccc2S)CC1 |
| InChI | InChI=1S/C18H22N4O2S2/c23-18(19-14-5-1-3-7-16(14)25)22-11-9-21(10-12-22)13-24-20-15-6-2-4-8-17(15)26/h1-8,20,25-26H,9-13H2,(H,19,23) |
| InChIKey | TWNOBIBCFFFEDY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|