C19H23FN4O — CID 18337387
5-(2-fluoro-3-pyridinyl)-1-methyl-N-[(2S,3R)-2-methyl-1-azabicyclo[2.2.2]octan-3-yl]pyrrole-2-carboxamide (PubChem CID 18337387) has the molecular formula C19H23FN4O and a molecular weight of 342.42 g/mol. Its IUPAC name is 5-(2-fluoro-3-pyridinyl)-1-methyl-N-[(2S,3R)-2-methyl-1-azabicyclo[2.2.2]octan-3-yl]pyrrole-2-carboxamide.
| Compound Name | 5-(2-fluoro-3-pyridinyl)-1-methyl-N-[(2S,3R)-2-methyl-1-azabicyclo[2.2.2]octan-3-yl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 18337387 |
| Molecular Formula | C19H23FN4O |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 5-(2-fluoro-3-pyridinyl)-1-methyl-N-[(2S,3R)-2-methyl-1-azabicyclo[2.2.2]octan-3-yl]pyrrole-2-carboxamide |
| SMILES | C[C@H]1[C@H](NC(=O)c2ccc(-c3cccnc3F)n2C)C2CCN1CC2 |
| InChI | InChI=1S/C19H23FN4O/c1-12-17(13-7-10-24(12)11-8-13)22-19(25)16-6-5-15(23(16)2)14-4-3-9-21-18(14)20/h3-6,9,12-13,17H,7-8,10-11H2,1-2H3,(H,22,25)/t12-,17-/m0/s1 |
| InChIKey | LEQHHFFLWLZKJM-SJCJKPOMSA-N |
| XLogP | 2.44 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|