C17H32N6O3 — CID 18338767
N,1-dibutyl-5-[3-(diaminomethylideneamino)propyl]-3,6-dioxopiperazine-2-carboxamide (PubChem CID 18338767) has the molecular formula C17H32N6O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is N,1-dibutyl-5-[3-(diaminomethylideneamino)propyl]-3,6-dioxopiperazine-2-carboxamide.
| Compound Name | N,1-dibutyl-5-[3-(diaminomethylideneamino)propyl]-3,6-dioxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 18338767 |
| Molecular Formula | C17H32N6O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | N,1-dibutyl-5-[3-(diaminomethylideneamino)propyl]-3,6-dioxopiperazine-2-carboxamide |
| SMILES | CCCCNC(=O)C1C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC |
| InChI | InChI=1S/C17H32N6O3/c1-3-5-9-20-14(24)13-15(25)22-12(8-7-10-21-17(18)19)16(26)23(13)11-6-4-2/h12-13H,3-11H2,1-2H3,(H,20,24)(H,22,25)(H4,18,19,21) |
| InChIKey | WIHQBKWMZHMOOX-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|