C7H10S — CID 18339226
4,5-dimethyl-2-methylidene-3H-thiophene (PubChem CID 18339226) has the molecular formula C7H10S and a molecular weight of 126.22 g/mol. Its IUPAC name is 4,5-dimethyl-2-methylidene-3H-thiophene.
| Compound Name | 4,5-dimethyl-2-methylidene-3H-thiophene |
|---|---|
| PubChem CID | 18339226 |
| Molecular Formula | C7H10S |
| Molecular Weight | 126.22 g/mol |
| Exact Mass | 126.05 |
| IUPAC Name | 4,5-dimethyl-2-methylidene-3H-thiophene |
| SMILES | C=C1CC(C)=C(C)S1 |
| InChI | InChI=1S/C7H10S/c1-5-4-6(2)8-7(5)3/h2,4H2,1,3H3 |
| InChIKey | VCQSXMFVMRORPG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |