C8H10S — CID 91270080
2,3-dimethyl-4,5-dimethylidenethiophene (PubChem CID 91270080) has the molecular formula C8H10S and a molecular weight of 138.23 g/mol. Its IUPAC name is 2,3-dimethyl-4,5-dimethylidenethiophene.
| Compound Name | 2,3-dimethyl-4,5-dimethylidenethiophene |
|---|---|
| PubChem CID | 91270080 |
| Molecular Formula | C8H10S |
| Molecular Weight | 138.23 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | 2,3-dimethyl-4,5-dimethylidenethiophene |
| SMILES | C=c1sc(C)c(C)c1=C |
| InChI | InChI=1S/C8H10S/c1-5-6(2)8(4)9-7(5)3/h1,3H2,2,4H3 |
| InChIKey | IVOVCKCEFAWNNW-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |