C9H19N3O — CID 18340111
1-[3-(ethylamino)propyl]-1,3-diazinan-2-one (PubChem CID 18340111) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-[3-(ethylamino)propyl]-1,3-diazinan-2-one.
| Compound Name | 1-[3-(ethylamino)propyl]-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 18340111 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 1-[3-(ethylamino)propyl]-1,3-diazinan-2-one |
| SMILES | CCNCCCN1CCCNC1=O |
| InChI | InChI=1S/C9H19N3O/c1-2-10-5-3-7-12-8-4-6-11-9(12)13/h10H,2-8H2,1H3,(H,11,13) |
| InChIKey | HDDMRRHFQBTSTO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|