C22H28N2O6 — CID 18343654
7-oxabicyclo[4.1.0]heptan-3-ylmethyl N-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxycarbonylamino)phenyl]carbamate (PubChem CID 18343654) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]heptan-3-ylmethyl N-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxycarbonylamino)phenyl]carbamate.
| Compound Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl N-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxycarbonylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 18343654 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl N-[4-(7-oxabicyclo[4.1.0]heptan-3-ylmethoxycarbonylamino)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(NC(=O)OCC2CCC3OC3C2)cc1)OCC1CCC2OC2C1 |
| InChI | InChI=1S/C22H28N2O6/c25-21(27-11-13-1-7-17-19(9-13)29-17)23-15-3-5-16(6-4-15)24-22(26)28-12-14-2-8-18-20(10-14)30-18/h3-6,13-14,17-20H,1-2,7-12H2,(H,23,25)(H,24,26) |
| InChIKey | MDWOGDMOLRQOSI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 101.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|